C10H12ClF2N — CID 130133970
2-(5-chloro-2,4-difluorophenyl)butan-2-amine (PubChem CID 130133970) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is 2-(5-chloro-2,4-difluorophenyl)butan-2-amine.
| Compound Name | 2-(5-chloro-2,4-difluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 130133970 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-(5-chloro-2,4-difluorophenyl)butan-2-amine |
| SMILES | CCC(C)(N)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C10H12ClF2N/c1-3-10(2,14)6-4-7(11)9(13)5-8(6)12/h4-5H,3,14H2,1-2H3 |
| InChIKey | QOHDLVPBKIKBCP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|