C14H9Cl2F4N — CID 62963746
1-(2,4-dichloro-5-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 62963746) has the molecular formula C14H9Cl2F4N and a molecular weight of 338.13 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 62963746 |
| Molecular Formula | C14H9Cl2F4N |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CC(N)(c1cc(F)c(Cl)cc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9Cl2F4N/c1-14(21,6-2-3-10(17)13(20)12(6)19)7-4-11(18)9(16)5-8(7)15/h2-5H,21H2,1H3 |
| InChIKey | DQCSDHSPYWARDZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|