C14H13Cl2FN2 — CID 115373843
1-(2,4-dichloro-5-fluorophenyl)-1-(5-methyl-3-pyridinyl)ethanamine (PubChem CID 115373843) has the molecular formula C14H13Cl2FN2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-1-(5-methyl-3-pyridinyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(5-methyl-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 115373843 |
| Molecular Formula | C14H13Cl2FN2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-1-(5-methyl-3-pyridinyl)ethanamine |
| SMILES | Cc1cncc(C(C)(N)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H13Cl2FN2/c1-8-3-9(7-19-6-8)14(2,18)10-4-13(17)12(16)5-11(10)15/h3-7H,18H2,1-2H3 |
| InChIKey | QFASKMLATJSRLB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|