C9H10ClF2NO — CID 130690627
(2R)-2-amino-2-(2-chloro-4,5-difluorophenyl)propan-1-ol (PubChem CID 130690627) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-chloro-4,5-difluorophenyl)propan-1-ol.
| Compound Name | (2R)-2-amino-2-(2-chloro-4,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130690627 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | (2R)-2-amino-2-(2-chloro-4,5-difluorophenyl)propan-1-ol |
| SMILES | C[C@](N)(CO)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C9H10ClF2NO/c1-9(13,4-14)5-2-7(11)8(12)3-6(5)10/h2-3,14H,4,13H2,1H3/t9-/m0/s1 |
| InChIKey | HZPVZRHBOLNFPF-VIFPVBQESA-N |
| XLogP | 1.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|