C9H10F2INO — CID 130690674
(2S)-2-amino-2-(2,6-difluoro-4-iodophenyl)propan-1-ol (PubChem CID 130690674) has the molecular formula C9H10F2INO and a molecular weight of 313.09 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,6-difluoro-4-iodophenyl)propan-1-ol.
| Compound Name | (2S)-2-amino-2-(2,6-difluoro-4-iodophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130690674 |
| Molecular Formula | C9H10F2INO |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | (2S)-2-amino-2-(2,6-difluoro-4-iodophenyl)propan-1-ol |
| SMILES | C[C@@](N)(CO)c1c(F)cc(I)cc1F |
| InChI | InChI=1S/C9H10F2INO/c1-9(13,4-14)8-6(10)2-5(12)3-7(8)11/h2-3,14H,4,13H2,1H3/t9-/m1/s1 |
| InChIKey | APCVUCFLCBISSO-SECBINFHSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|