C10H13F2NO — CID 130691213
(2R)-2-amino-2-(2,6-difluoro-3-methylphenyl)propan-1-ol (PubChem CID 130691213) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,6-difluoro-3-methylphenyl)propan-1-ol.
| Compound Name | (2R)-2-amino-2-(2,6-difluoro-3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 130691213 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (2R)-2-amino-2-(2,6-difluoro-3-methylphenyl)propan-1-ol |
| SMILES | Cc1ccc(F)c([C@@](C)(N)CO)c1F |
| InChI | InChI=1S/C10H13F2NO/c1-6-3-4-7(11)8(9(6)12)10(2,13)5-14/h3-4,14H,5,13H2,1-2H3/t10-/m0/s1 |
| InChIKey | RJZHEBGBHAXZEX-JTQLQIEISA-N |
| XLogP | 1.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |