About (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol
(2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol (PubChem CID 130742500) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol |
| PubChem CID | 130742500 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol |
| SMILES | C[C@](N)(CO)c1ncc(F)cc1F |
| InChI | InChI=1S/C8H10F2N2O/c1-8(11,4-13)7-6(10)2-5(9)3-12-7/h2-3,13H,4,11H2,1H3/t8-/m0/s1 |
| InChIKey | XINUJUYPIZWXHY-QMMMGPOBSA-N |
| XLogP | 0.53 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol?
The IUPAC name of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol (CID 130742500) is (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol.
What is the SMILES notation for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol?
The canonical SMILES for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol is C[C@](N)(CO)c1ncc(F)cc1F.
What is the InChIKey of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol?
The InChIKey is XINUJUYPIZWXHY-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H10F2N2O/c1-8(11,4-13)7-6(10)2-5(9)3-12-7/h2-3,13H,4,11H2,1H3/t8-/m0/s1.
What are the key properties of (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol?
(2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol has a molecular weight of 188.18 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(3,5-difluoro-2-pyridinyl)propan-1-ol is sourced from PubChem (CID 130742500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).