C12H15Cl2FO — CID 60928779
2-(2,4-dichloro-5-fluorophenyl)-4-methylpentan-2-ol (PubChem CID 60928779) has the molecular formula C12H15Cl2FO and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-4-methylpentan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 60928779 |
| Molecular Formula | C12H15Cl2FO |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-4-methylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2FO/c1-7(2)6-12(3,16)8-4-11(15)10(14)5-9(8)13/h4-5,7,16H,6H2,1-3H3 |
| InChIKey | GUGJUMUXYBMUCT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|