C15H11Cl3F2O — CID 114851814
1-(4-chloro-2-fluorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol (PubChem CID 114851814) has the molecular formula C15H11Cl3F2O and a molecular weight of 351.61 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 114851814 |
| Molecular Formula | C15H11Cl3F2O |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1ccc(Cl)cc1F)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl3F2O/c1-15(21,7-8-2-3-9(16)4-13(8)19)10-5-14(20)12(18)6-11(10)17/h2-6,21H,7H2,1H3 |
| InChIKey | CVTRIFCCXVXLSD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|