C15H11Cl2F3O — CID 63407094
2-(2,4-dichloro-5-fluorophenyl)-1-(2,5-difluorophenyl)propan-2-ol (PubChem CID 63407094) has the molecular formula C15H11Cl2F3O and a molecular weight of 335.15 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-(2,5-difluorophenyl)propan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2,5-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 63407094 |
| Molecular Formula | C15H11Cl2F3O |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2,5-difluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1cc(F)ccc1F)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2F3O/c1-15(21,7-8-4-9(18)2-3-13(8)19)10-5-14(20)12(17)6-11(10)16/h2-6,21H,7H2,1H3 |
| InChIKey | XRHWVSGKWHIYMK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|