C15H12Cl2F2O — CID 63406675
2-(2,4-dichloro-5-fluorophenyl)-1-(2-fluorophenyl)propan-2-ol (PubChem CID 63406675) has the molecular formula C15H12Cl2F2O and a molecular weight of 317.16 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-(2-fluorophenyl)propan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 63406675 |
| Molecular Formula | C15H12Cl2F2O |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1ccccc1F)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2F2O/c1-15(20,8-9-4-2-3-5-13(9)18)10-6-14(19)12(17)7-11(10)16/h2-7,20H,8H2,1H3 |
| InChIKey | ZQCGHARMNMXKFJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|