C17H17Cl2FO — CID 63407051
2-(2,4-dichloro-5-fluorophenyl)-1-(4-ethylphenyl)propan-2-ol (PubChem CID 63407051) has the molecular formula C17H17Cl2FO and a molecular weight of 327.23 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-(4-ethylphenyl)propan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(4-ethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 63407051 |
| Molecular Formula | C17H17Cl2FO |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(4-ethylphenyl)propan-2-ol |
| SMILES | CCc1ccc(CC(C)(O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2FO/c1-3-11-4-6-12(7-5-11)10-17(2,21)13-8-16(20)15(19)9-14(13)18/h4-9,21H,3,10H2,1-2H3 |
| InChIKey | IQFINYORYIXMHL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|