C16H23Cl2FO — CID 63407052
2-(2,4-dichloro-5-fluorophenyl)-4-ethyloctan-2-ol (PubChem CID 63407052) has the molecular formula C16H23Cl2FO and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-4-ethyloctan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-4-ethyloctan-2-ol |
|---|---|
| PubChem CID | 63407052 |
| Molecular Formula | C16H23Cl2FO |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-4-ethyloctan-2-ol |
| SMILES | CCCCC(CC)CC(C)(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl2FO/c1-4-6-7-11(5-2)10-16(3,20)12-8-15(19)14(18)9-13(12)17/h8-9,11,20H,4-7,10H2,1-3H3 |
| InChIKey | IUDSRLYIYWNUIN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|