C12H16Cl2FNO2 — CID 62774391
2-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethylamino)propan-2-ol (PubChem CID 62774391) has the molecular formula C12H16Cl2FNO2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 62774391 |
| Molecular Formula | C12H16Cl2FNO2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(C)(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2FNO2/c1-12(17,7-16-3-4-18-2)8-5-11(15)10(14)6-9(8)13/h5-6,16-17H,3-4,7H2,1-2H3 |
| InChIKey | WCYBMZYSFWMBEU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|