C10H9Cl2FO3 — CID 62214465
methyl 2-(2,4-dichloro-5-fluorophenyl)-2-hydroxypropanoate (PubChem CID 62214465) has the molecular formula C10H9Cl2FO3 and a molecular weight of 267.08 g/mol. Its IUPAC name is methyl 2-(2,4-dichloro-5-fluorophenyl)-2-hydroxypropanoate.
| Compound Name | methyl 2-(2,4-dichloro-5-fluorophenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 62214465 |
| Molecular Formula | C10H9Cl2FO3 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | methyl 2-(2,4-dichloro-5-fluorophenyl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2FO3/c1-10(15,9(14)16-2)5-3-8(13)7(12)4-6(5)11/h3-4,15H,1-2H3 |
| InChIKey | IBYLFQSMCIOZAK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|