C14H19Cl2FN2O2 — CID 61001178
methyl 2-(2,4-dichloro-5-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanoate (PubChem CID 61001178) has the molecular formula C14H19Cl2FN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is methyl 2-(2,4-dichloro-5-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanoate.
| Compound Name | methyl 2-(2,4-dichloro-5-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanoate |
|---|---|
| PubChem CID | 61001178 |
| Molecular Formula | C14H19Cl2FN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 2-(2,4-dichloro-5-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanoate |
| SMILES | COC(=O)C(C)(NCCN(C)C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2FN2O2/c1-14(13(20)21-4,18-5-6-19(2)3)9-7-12(17)11(16)8-10(9)15/h7-8,18H,5-6H2,1-4H3 |
| InChIKey | ZYWADLZJOLTJLL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|