C13H19ClFN3O — CID 54891418
2-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide (PubChem CID 54891418) has the molecular formula C13H19ClFN3O and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 54891418 |
| Molecular Formula | C13H19ClFN3O |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide |
| SMILES | CN(C)CCNC(C)(C(N)=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClFN3O/c1-13(12(16)19,17-6-7-18(2)3)9-4-5-11(15)10(14)8-9/h4-5,8,17H,6-7H2,1-3H3,(H2,16,19) |
| InChIKey | CWYGHYXOSZZEPS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |