C13H19BrFN3O — CID 82967482
2-(5-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide (PubChem CID 82967482) has the molecular formula C13H19BrFN3O and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 82967482 |
| Molecular Formula | C13H19BrFN3O |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(dimethylamino)ethylamino]propanamide |
| SMILES | CN(C)CCNC(C)(C(N)=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H19BrFN3O/c1-13(12(16)19,17-6-7-18(2)3)10-8-9(14)4-5-11(10)15/h4-5,8,17H,6-7H2,1-3H3,(H2,16,19) |
| InChIKey | JZSLJIISHFCWKM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |