C15H23BrFN3O — CID 82953788
2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanamide (PubChem CID 82953788) has the molecular formula C15H23BrFN3O and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanamide.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 82953788 |
| Molecular Formula | C15H23BrFN3O |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanamide |
| SMILES | CCN(CC)CCNC(C)(C(N)=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H23BrFN3O/c1-4-20(5-2)9-8-19-15(3,14(18)21)12-10-11(16)6-7-13(12)17/h6-7,10,19H,4-5,8-9H2,1-3H3,(H2,18,21) |
| InChIKey | WHGHMMGBHWVKSA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |