C15H21BrFN3 — CID 82967784
2-(4-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanenitrile (PubChem CID 82967784) has the molecular formula C15H21BrFN3 and a molecular weight of 342.26 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanenitrile.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 82967784 |
| Molecular Formula | C15H21BrFN3 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propanenitrile |
| SMILES | CCN(CC)CCNC(C)(C#N)c1ccc(Br)cc1F |
| InChI | InChI=1S/C15H21BrFN3/c1-4-20(5-2)9-8-19-15(3,11-18)13-7-6-12(16)10-14(13)17/h6-7,10,19H,4-5,8-9H2,1-3H3 |
| InChIKey | QYRSCLRPCKSOSV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |