C12H10BrFN2 — CID 82966921
2-(5-bromo-2-fluorophenyl)-2-(prop-2-ynylamino)propanenitrile (PubChem CID 82966921) has the molecular formula C12H10BrFN2 and a molecular weight of 281.13 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-2-(prop-2-ynylamino)propanenitrile.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-2-(prop-2-ynylamino)propanenitrile |
|---|---|
| PubChem CID | 82966921 |
| Molecular Formula | C12H10BrFN2 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-2-(prop-2-ynylamino)propanenitrile |
| SMILES | C#CCNC(C)(C#N)c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H10BrFN2/c1-3-6-16-12(2,8-15)10-7-9(13)4-5-11(10)14/h1,4-5,7,16H,6H2,2H3 |
| InChIKey | VIVXJCZVRBTIKD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|