C12H14BrFN2 — CID 115129621
2-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpropanenitrile (PubChem CID 115129621) has the molecular formula C12H14BrFN2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpropanenitrile.
| Compound Name | 2-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 115129621 |
| Molecular Formula | C12H14BrFN2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H14BrFN2/c1-12(2,8-15)16-6-5-9-7-10(13)3-4-11(9)14/h3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | KUXLZLPCMIDOQH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |