C14H12BrFN4 — CID 115143395
6-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpyrimidine-4-carbonitrile (PubChem CID 115143395) has the molecular formula C14H12BrFN4 and a molecular weight of 335.18 g/mol. Its IUPAC name is 6-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpyrimidine-4-carbonitrile.
| Compound Name | 6-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 115143395 |
| Molecular Formula | C14H12BrFN4 |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 6-[2-(5-bromo-2-fluorophenyl)ethylamino]-2-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1nc(C#N)cc(NCCc2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C14H12BrFN4/c1-9-19-12(8-17)7-14(20-9)18-5-4-10-6-11(15)2-3-13(10)16/h2-3,6-7H,4-5H2,1H3,(H,18,19,20) |
| InChIKey | WHPZGXYBHNNCBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |