C14H14BrN5 — CID 115266748
[6-[2-(2-bromophenyl)ethylamino]-2-methylpyrimidin-4-yl]cyanamide (PubChem CID 115266748) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is [6-[2-(2-bromophenyl)ethylamino]-2-methylpyrimidin-4-yl]cyanamide.
| Compound Name | [6-[2-(2-bromophenyl)ethylamino]-2-methylpyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115266748 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [6-[2-(2-bromophenyl)ethylamino]-2-methylpyrimidin-4-yl]cyanamide |
| SMILES | Cc1nc(NC#N)cc(NCCc2ccccc2Br)n1 |
| InChI | InChI=1S/C14H14BrN5/c1-10-19-13(8-14(20-10)18-9-16)17-7-6-11-4-2-3-5-12(11)15/h2-5,8H,6-7H2,1H3,(H2,17,18,19,20) |
| InChIKey | NAWBRILAMUXZMB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|