C14H15N5O — CID 115266696
[6-[(3-methoxyphenyl)methylamino]-2-methylpyrimidin-4-yl]cyanamide (PubChem CID 115266696) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is [6-[(3-methoxyphenyl)methylamino]-2-methylpyrimidin-4-yl]cyanamide.
| Compound Name | [6-[(3-methoxyphenyl)methylamino]-2-methylpyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115266696 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | [6-[(3-methoxyphenyl)methylamino]-2-methylpyrimidin-4-yl]cyanamide |
| SMILES | COc1cccc(CNc2cc(NC#N)nc(C)n2)c1 |
| InChI | InChI=1S/C14H15N5O/c1-10-18-13(7-14(19-10)17-9-15)16-8-11-4-3-5-12(6-11)20-2/h3-7H,8H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | YLPGYZSIDXEPAT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|