C16H23N3O — CID 19625975
1-butyl-N-[(3-methoxyphenyl)methyl]-5-methylpyrazol-3-amine (PubChem CID 19625975) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-butyl-N-[(3-methoxyphenyl)methyl]-5-methylpyrazol-3-amine.
| Compound Name | 1-butyl-N-[(3-methoxyphenyl)methyl]-5-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 19625975 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-butyl-N-[(3-methoxyphenyl)methyl]-5-methylpyrazol-3-amine |
| SMILES | CCCCn1nc(NCc2cccc(OC)c2)cc1C |
| InChI | InChI=1S/C16H23N3O/c1-4-5-9-19-13(2)10-16(18-19)17-12-14-7-6-8-15(11-14)20-3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,17,18) |
| InChIKey | NYWXZIFJYOHVDM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |