C15H22ClN3O — CID 126965644
N-[(3-methoxyphenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride (PubChem CID 126965644) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126965644 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
| SMILES | CCCn1cc(NCc2cccc(OC)c2)c(C)n1.Cl |
| InChI | InChI=1S/C15H21N3O.ClH/c1-4-8-18-11-15(12(2)17-18)16-10-13-6-5-7-14(9-13)19-3;/h5-7,9,11,16H,4,8,10H2,1-3H3;1H |
| InChIKey | RANVJZDGSWGMPS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |