C13H22ClN5 — CID 126966840
N-[(1-ethylpyrazol-3-yl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride (PubChem CID 126966840) has the molecular formula C13H22ClN5 and a molecular weight of 283.81 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-3-yl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride.
| Compound Name | N-[(1-ethylpyrazol-3-yl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126966840 |
| Molecular Formula | C13H22ClN5 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[(1-ethylpyrazol-3-yl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
| SMILES | CCCn1cc(NCc2ccn(CC)n2)c(C)n1.Cl |
| InChI | InChI=1S/C13H21N5.ClH/c1-4-7-18-10-13(11(3)15-18)14-9-12-6-8-17(5-2)16-12;/h6,8,10,14H,4-5,7,9H2,1-3H3;1H |
| InChIKey | ROTFORPRCJVGKL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |