C14H19ClFN3 — CID 126964491
N-[(4-fluorophenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride (PubChem CID 126964491) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126964491 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methyl-1-propylpyrazol-4-amine;hydrochloride |
| SMILES | CCCn1cc(NCc2ccc(F)cc2)c(C)n1.Cl |
| InChI | InChI=1S/C14H18FN3.ClH/c1-3-8-18-10-14(11(2)17-18)16-9-12-4-6-13(15)7-5-12;/h4-7,10,16H,3,8-9H2,1-2H3;1H |
| InChIKey | DOOXIAUVMLLADE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |