C18H26FN5 — CID 112870537
6-N-[3-(dimethylamino)propyl]-4-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4,6-diamine (PubChem CID 112870537) has the molecular formula C18H26FN5 and a molecular weight of 331.44 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-4-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-4-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112870537 |
| Molecular Formula | C18H26FN5 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-4-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCCN(C)C)cc(NCCc2ccccc2F)n1 |
| InChI | InChI=1S/C18H26FN5/c1-14-22-17(20-10-6-12-24(2)3)13-18(23-14)21-11-9-15-7-4-5-8-16(15)19/h4-5,7-8,13H,6,9-12H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | PZSIDQVINXUIEF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|