C16H24N6 — CID 112870532
6-N-[3-(dimethylamino)propyl]-2-methyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112870532) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-2-methyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-2-methyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112870532 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-2-methyl-4-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCCN(C)C)cc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C16H24N6/c1-13-20-15(18-9-6-10-22(2)3)11-16(21-13)19-12-14-7-4-5-8-17-14/h4-5,7-8,11H,6,9-10,12H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | MLGKTYRCFMWBLP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|