C16H22ClN5 — CID 112870610
4-N-(4-chlorophenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine (PubChem CID 112870610) has the molecular formula C16H22ClN5 and a molecular weight of 319.84 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112870610 |
| Molecular Formula | C16H22ClN5 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCCN(C)C)cc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H22ClN5/c1-12-19-15(18-9-4-10-22(2)3)11-16(20-12)21-14-7-5-13(17)6-8-14/h5-8,11H,4,9-10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | UHXANPMZNMSVEJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|