C17H24BrN5 — CID 112870659
4-N-(4-bromo-3-methylphenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine (PubChem CID 112870659) has the molecular formula C17H24BrN5 and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-N-(4-bromo-3-methylphenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-bromo-3-methylphenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112870659 |
| Molecular Formula | C17H24BrN5 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-N-(4-bromo-3-methylphenyl)-6-N-[3-(dimethylamino)propyl]-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCCN(C)C)cc(Nc2ccc(Br)c(C)c2)n1 |
| InChI | InChI=1S/C17H24BrN5/c1-12-10-14(6-7-15(12)18)22-17-11-16(20-13(2)21-17)19-8-5-9-23(3)4/h6-7,10-11H,5,8-9H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | HKVGBKPZMUNIFH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|