C19H27N5O — CID 109366623
6-[3-(dimethylamino)propylamino]-N-(3,4-dimethylphenyl)-2-methylpyrimidine-4-carboxamide (PubChem CID 109366623) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propylamino]-N-(3,4-dimethylphenyl)-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[3-(dimethylamino)propylamino]-N-(3,4-dimethylphenyl)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366623 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 6-[3-(dimethylamino)propylamino]-N-(3,4-dimethylphenyl)-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCCCN(C)C)cc(C(=O)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C19H27N5O/c1-13-7-8-16(11-14(13)2)23-19(25)17-12-18(22-15(3)21-17)20-9-6-10-24(4)5/h7-8,11-12H,6,9-10H2,1-5H3,(H,23,25)(H,20,21,22) |
| InChIKey | RYDPPCAEQKQEQQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|