C17H23N5O — CID 109366614
6-[3-(dimethylamino)propylamino]-2-methyl-N-phenylpyrimidine-4-carboxamide (PubChem CID 109366614) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propylamino]-2-methyl-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-[3-(dimethylamino)propylamino]-2-methyl-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366614 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 6-[3-(dimethylamino)propylamino]-2-methyl-N-phenylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCCCN(C)C)cc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H23N5O/c1-13-19-15(17(23)21-14-8-5-4-6-9-14)12-16(20-13)18-10-7-11-22(2)3/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,21,23)(H,18,19,20) |
| InChIKey | ZHIKKYRTBUDASC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|