C19H26ClN5O — CID 109366648
N-(2-chloro-4,6-dimethylphenyl)-6-[3-(dimethylamino)propylamino]-2-methylpyrimidine-4-carboxamide (PubChem CID 109366648) has the molecular formula C19H26ClN5O and a molecular weight of 375.90 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-6-[3-(dimethylamino)propylamino]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-6-[3-(dimethylamino)propylamino]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109366648 |
| Molecular Formula | C19H26ClN5O |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-6-[3-(dimethylamino)propylamino]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc(NCCCN(C)C)nc(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H26ClN5O/c1-12-9-13(2)18(15(20)10-12)24-19(26)16-11-17(23-14(3)22-16)21-7-6-8-25(4)5/h9-11H,6-8H2,1-5H3,(H,24,26)(H,21,22,23) |
| InChIKey | XZSRQZVUQAZLPD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|