C13H11BrFN5 — CID 115264714
[6-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrimidin-4-yl]cyanamide (PubChem CID 115264714) has the molecular formula C13H11BrFN5 and a molecular weight of 336.17 g/mol. Its IUPAC name is [6-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrimidin-4-yl]cyanamide.
| Compound Name | [6-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115264714 |
| Molecular Formula | C13H11BrFN5 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | [6-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrimidin-4-yl]cyanamide |
| SMILES | N#CNc1cc(NCCc2cc(Br)ccc2F)ncn1 |
| InChI | InChI=1S/C13H11BrFN5/c14-10-1-2-11(15)9(5-10)3-4-17-12-6-13(18-7-16)20-8-19-12/h1-2,5-6,8H,3-4H2,(H2,17,18,19,20) |
| InChIKey | CNBLPGFINKEHAB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|