C12H9BrFN5 — CID 115264792
2-[[6-(5-bromo-2-fluoroanilino)pyrimidin-4-yl]amino]acetonitrile (PubChem CID 115264792) has the molecular formula C12H9BrFN5 and a molecular weight of 322.14 g/mol. Its IUPAC name is 2-[[6-(5-bromo-2-fluoroanilino)pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[6-(5-bromo-2-fluoroanilino)pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115264792 |
| Molecular Formula | C12H9BrFN5 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2-[[6-(5-bromo-2-fluoroanilino)pyrimidin-4-yl]amino]acetonitrile |
| SMILES | N#CCNc1cc(Nc2cc(Br)ccc2F)ncn1 |
| InChI | InChI=1S/C12H9BrFN5/c13-8-1-2-9(14)10(5-8)19-12-6-11(16-4-3-15)17-7-18-12/h1-2,5-7H,4H2,(H2,16,17,18,19) |
| InChIKey | OUWMSGCIBYNDMY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|