C11H10N6 — CID 115264796
2-[[6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]acetonitrile (PubChem CID 115264796) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[[6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115264796 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[[6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]acetonitrile |
| SMILES | N#CCNc1cc(Nc2ccncc2)ncn1 |
| InChI | InChI=1S/C11H10N6/c12-3-6-14-10-7-11(16-8-15-10)17-9-1-4-13-5-2-9/h1-2,4-5,7-8H,6H2,(H2,13,14,15,16,17) |
| InChIKey | KCKXRRZSTHDOHI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|