C10H10N4O2 — CID 129090569
[6-(pyridin-4-ylamino)pyrimidin-4-yl]methanediol (PubChem CID 129090569) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is [6-(pyridin-4-ylamino)pyrimidin-4-yl]methanediol.
| Compound Name | [6-(pyridin-4-ylamino)pyrimidin-4-yl]methanediol |
|---|---|
| PubChem CID | 129090569 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [6-(pyridin-4-ylamino)pyrimidin-4-yl]methanediol |
| SMILES | OC(O)c1cc(Nc2ccncc2)ncn1 |
| InChI | InChI=1S/C10H10N4O2/c15-10(16)8-5-9(13-6-12-8)14-7-1-3-11-4-2-7/h1-6,10,15-16H,(H,11,12,13,14) |
| InChIKey | VJJAKUFQWUEGPE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|