C27H30N8O — CID 150888765
2,4-bis[4-[[6-(methylamino)pyrimidin-4-yl]amino]phenyl]pentan-3-one (PubChem CID 150888765) has the molecular formula C27H30N8O and a molecular weight of 482.59 g/mol. Its IUPAC name is 2,4-bis[4-[[6-(methylamino)pyrimidin-4-yl]amino]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[[6-(methylamino)pyrimidin-4-yl]amino]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 150888765 |
| Molecular Formula | C27H30N8O |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2,4-bis[4-[[6-(methylamino)pyrimidin-4-yl]amino]phenyl]pentan-3-one |
| SMILES | CNc1cc(Nc2ccc(C(C)C(=O)C(C)c3ccc(Nc4cc(NC)ncn4)cc3)cc2)ncn1 |
| InChI | InChI=1S/C27H30N8O/c1-17(19-5-9-21(10-6-19)34-25-13-23(28-3)30-15-32-25)27(36)18(2)20-7-11-22(12-8-20)35-26-14-24(29-4)31-16-33-26/h5-18H,1-4H3,(H2,28,30,32,34)(H2,29,31,33,35) |
| InChIKey | KXOVRTJVMOBZSN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |