C20H21N5O — CID 112859381
N-[4-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112859381) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[4-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112859381 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[4-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc(NC(C)c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C20H21N5O/c1-14(16-6-4-3-5-7-16)23-19-12-20(22-13-21-19)25-18-10-8-17(9-11-18)24-15(2)26/h3-14H,1-2H3,(H,24,26)(H2,21,22,23,25) |
| InChIKey | AVBAUEHYKCNIJV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |