C19H17N5 — CID 112859405
3-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112859405) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 3-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112859405 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[[6-(1-phenylethylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CC(Nc1cc(Nc2cccc(C#N)c2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C19H17N5/c1-14(16-7-3-2-4-8-16)23-18-11-19(22-13-21-18)24-17-9-5-6-15(10-17)12-20/h2-11,13-14H,1H3,(H2,21,22,23,24) |
| InChIKey | UNQJDFBTPTWTQN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |