C11H10Cl2N4 — CID 80768521
4-N-(3,5-dichlorophenyl)-6-N-methylpyrimidine-4,6-diamine (PubChem CID 80768521) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80768521 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2cc(Cl)cc(Cl)c2)ncn1 |
| InChI | InChI=1S/C11H10Cl2N4/c1-14-10-5-11(16-6-15-10)17-9-3-7(12)2-8(13)4-9/h2-6H,1H3,(H2,14,15,16,17) |
| InChIKey | WYZDKTFVNWSAQN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |