C12H14N4O2S — CID 80762676
6-N-methyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,6-diamine (PubChem CID 80762676) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 6-N-methyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80762676 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 6-N-methyl-4-N-(4-methylsulfonylphenyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2ccc(S(C)(=O)=O)cc2)ncn1 |
| InChI | InChI=1S/C12H14N4O2S/c1-13-11-7-12(15-8-14-11)16-9-3-5-10(6-4-9)19(2,17)18/h3-8H,1-2H3,(H2,13,14,15,16) |
| InChIKey | AOCCHKWTPLCIDZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |