C18H19N5O4S2 — CID 53330722
N-methyl-3-[[6-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 53330722) has the molecular formula C18H19N5O4S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-methyl-3-[[6-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-methyl-3-[[6-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 53330722 |
| Molecular Formula | C18H19N5O4S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-methyl-3-[[6-(3-methylsulfonylanilino)pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(Nc2cc(Nc3cccc(S(C)(=O)=O)c3)ncn2)c1 |
| InChI | InChI=1S/C18H19N5O4S2/c1-19-29(26,27)16-8-4-6-14(10-16)23-18-11-17(20-12-21-18)22-13-5-3-7-15(9-13)28(2,24)25/h3-12,19H,1-2H3,(H2,20,21,22,23) |
| InChIKey | WTEYTDJQFFFYQQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |