C20H24N6O3S — CID 177005071
N-methyl-3-[[6-[4-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 177005071) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-methyl-3-[[6-[4-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-methyl-3-[[6-[4-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 177005071 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-methyl-3-[[6-[4-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CNCCOc1ccc(Nc2cc(Nc3cccc(S(=O)(=O)NC)c3)ncn2)cc1 |
| InChI | InChI=1S/C20H24N6O3S/c1-21-10-11-29-17-8-6-15(7-9-17)25-19-13-20(24-14-23-19)26-16-4-3-5-18(12-16)30(27,28)22-2/h3-9,12-14,21-22H,10-11H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | XVCHNNGTEROPEO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|