C21H19N5O2S2 — CID 53328616
N-methyl-3-[[6-(4-thiophen-2-ylanilino)pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 53328616) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-methyl-3-[[6-(4-thiophen-2-ylanilino)pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-methyl-3-[[6-(4-thiophen-2-ylanilino)pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 53328616 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-methyl-3-[[6-(4-thiophen-2-ylanilino)pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(Nc2cc(Nc3ccc(-c4cccs4)cc3)ncn2)c1 |
| InChI | InChI=1S/C21H19N5O2S2/c1-22-30(27,28)18-5-2-4-17(12-18)26-21-13-20(23-14-24-21)25-16-9-7-15(8-10-16)19-6-3-11-29-19/h2-14,22H,1H3,(H2,23,24,25,26) |
| InChIKey | PGIZWHKJFCPTAD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |