C13H10N6O — CID 115264789
2-[[6-(1,3-benzoxazol-6-ylamino)pyrimidin-4-yl]amino]acetonitrile (PubChem CID 115264789) has the molecular formula C13H10N6O and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-[[6-(1,3-benzoxazol-6-ylamino)pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[6-(1,3-benzoxazol-6-ylamino)pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115264789 |
| Molecular Formula | C13H10N6O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[[6-(1,3-benzoxazol-6-ylamino)pyrimidin-4-yl]amino]acetonitrile |
| SMILES | N#CCNc1cc(Nc2ccc3ncoc3c2)ncn1 |
| InChI | InChI=1S/C13H10N6O/c14-3-4-15-12-6-13(17-7-16-12)19-9-1-2-10-11(5-9)20-8-18-10/h1-2,5-8H,4H2,(H2,15,16,17,19) |
| InChIKey | LQLWCHOEGLXVEX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|