C13H11ClN4O — CID 135380621
N-[2-(1,3-benzoxazol-6-yl)ethyl]-6-chloropyrimidin-4-amine (PubChem CID 135380621) has the molecular formula C13H11ClN4O and a molecular weight of 274.71 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-6-yl)ethyl]-6-chloropyrimidin-4-amine.
| Compound Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-6-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 135380621 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-6-chloropyrimidin-4-amine |
| SMILES | Clc1cc(NCCc2ccc3ncoc3c2)ncn1 |
| InChI | InChI=1S/C13H11ClN4O/c14-12-6-13(17-7-16-12)15-4-3-9-1-2-10-11(5-9)19-8-18-10/h1-2,5-8H,3-4H2,(H,15,16,17) |
| InChIKey | ZMEWHLZNEJFCOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |